C9H13O4+ — CID 163611242
(3aS,7S)-7-hydroxy-2,2-dimethyl-7,7a-dihydro-3aH-1,3-benzodioxol-3-ium-4-one (PubChem CID 163611242) has the molecular formula C9H13O4+ and a molecular weight of 185.20 g/mol. Its IUPAC name is (3aS,7S)-7-hydroxy-2,2-dimethyl-7,7a-dihydro-3aH-1,3-benzodioxol-3-ium-4-one.
| Compound Name | (3aS,7S)-7-hydroxy-2,2-dimethyl-7,7a-dihydro-3aH-1,3-benzodioxol-3-ium-4-one |
|---|---|
| PubChem CID | 163611242 |
| Molecular Formula | C9H13O4+ |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | (3aS,7S)-7-hydroxy-2,2-dimethyl-7,7a-dihydro-3aH-1,3-benzodioxol-3-ium-4-one |
| SMILES | CC1(C)OC2[C@H]([OH+]1)C(=O)C=C[C@@H]2O |
| InChI | InChI=1S/C9H12O4/c1-9(2)12-7-5(10)3-4-6(11)8(7)13-9/h3-5,7-8,10H,1-2H3/p+1/t5-,7?,8+/m0/s1 |
| InChIKey | HGCFQLJTJYOOEV-IRAGSFCVSA-O |
| XLogP | -0.48 |
| TPSA | 59.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|