C26H28O13 — CID 163611505
methyl (7R)-4'-[hydroxy-(4-hydroxyphenyl)methyl]-5'-oxo-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyspiro[4a,7a-dihydro-1H-cyclopenta[c]pyran-7,2'-furan]-4-carboxylate (PubChem CID 163611505) has the molecular formula C26H28O13 and a molecular weight of 548.50 g/mol. Its IUPAC name is methyl (7R)-4'-[hydroxy-(4-hydroxyphenyl)methyl]-5'-oxo-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyspiro[4a,7a-dihydro-1H-cyclopenta[c]pyran-7,2'-furan]-4-carboxylate.
| Compound Name | methyl (7R)-4'-[hydroxy-(4-hydroxyphenyl)methyl]-5'-oxo-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyspiro[4a,7a-dihydro-1H-cyclopenta[c]pyran-7,2'-furan]-4-carboxylate |
|---|---|
| PubChem CID | 163611505 |
| Molecular Formula | C26H28O13 |
| Molecular Weight | 548.50 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | methyl (7R)-4'-[hydroxy-(4-hydroxyphenyl)methyl]-5'-oxo-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyspiro[4a,7a-dihydro-1H-cyclopenta[c]pyran-7,2'-furan]-4-carboxylate |
| SMILES | COC(=O)C1=COC(OC2OC(CO)C(O)C(O)C2O)C2C1C=C[C@@]21C=C(C(O)c2ccc(O)cc2)C(=O)O1 |
| InChI | InChI=1S/C26H28O13/c1-35-22(33)15-10-36-24(38-25-21(32)20(31)19(30)16(9-27)37-25)17-13(15)6-7-26(17)8-14(23(34)39-26)18(29)11-2-4-12(28)5-3-11/h2-8,10,13,16-21,24-25,27-32H,9H2,1H3/t13?,16?,17?,18?,19?,20?,21?,24?,25?,26-/m1/s1 |
| InChIKey | HGHZVZYRYYMUTI-JTXQQRCRSA-N |
| XLogP | -1.32 |
| TPSA | 201.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.50 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|