C36H44AlN2O12S — CID 163611601
CID 163611601 (PubChem CID 163611601) has the molecular formula C36H44AlN2O12S and a molecular weight of 755.80 g/mol.
| Compound Name | CID 163611601 |
|---|---|
| PubChem CID | 163611601 |
| Molecular Formula | C36H44AlN2O12S |
| Molecular Weight | 755.80 g/mol |
| Exact Mass | 755.24 |
| IUPAC Name | — |
| SMILES | CC[Al]SC(C)CNC(=O)[C@]1(O)Cc2c(O)c3c(c(O)c2[C@@H](O[C@H]2C[C@H]4[C@H](O[C@@H]5[C@@H](OC)OCCN54)[C@H](C)O2)C1)C(=O)c1c(OC)cccc1C3=O |
| InChI | InChI=1S/C34H40N2O12S.C2H5.Al/c1-14(49)13-35-33(41)34(42)11-17-23(29(40)25-24(27(17)38)26(37)16-6-5-7-19(43-3)22(16)28(25)39)20(12-34)47-21-10-18-30(15(2)46-21)48-31-32(44-4)45-9-8-36(18)31;1-2;/h5-7,14-15,18,20-21,30-32,38,40,42,49H,8-13H2,1-4H3,(H,35,41);1H2,2H3;/q;;+1/p-1/t14?,15-,18-,20-,21-,30+,31+,32-,34-;;/m0../s1 |
| InChIKey | SEEKOEDEBSASIM-MQILHMQQSA-M |
| XLogP | 2.45 |
| TPSA | 182.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.80 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|