C10H14O2 — CID 163611773
1-(2,6-dimethylideneoxan-4-yl)propan-2-one (PubChem CID 163611773) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is 1-(2,6-dimethylideneoxan-4-yl)propan-2-one.
| Compound Name | 1-(2,6-dimethylideneoxan-4-yl)propan-2-one |
|---|---|
| PubChem CID | 163611773 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 1-(2,6-dimethylideneoxan-4-yl)propan-2-one |
| SMILES | C=C1CC(CC(C)=O)CC(=C)O1 |
| InChI | InChI=1S/C10H14O2/c1-7(11)4-10-5-8(2)12-9(3)6-10/h10H,2-6H2,1H3 |
| InChIKey | HGNPXDYDKBDXJT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |