C28H35F3N4O — CID 163612036
3-[(1R,3R)-1-[4-[(1-butylazetidin-3-yl)amino]phenyl]-8-fluoro-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropan-1-ol (PubChem CID 163612036) has the molecular formula C28H35F3N4O and a molecular weight of 500.61 g/mol. Its IUPAC name is 3-[(1R,3R)-1-[4-[(1-butylazetidin-3-yl)amino]phenyl]-8-fluoro-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropan-1-ol.
| Compound Name | 3-[(1R,3R)-1-[4-[(1-butylazetidin-3-yl)amino]phenyl]-8-fluoro-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 163612036 |
| Molecular Formula | C28H35F3N4O |
| Molecular Weight | 500.61 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | 3-[(1R,3R)-1-[4-[(1-butylazetidin-3-yl)amino]phenyl]-8-fluoro-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropan-1-ol |
| SMILES | CCCCN1CC(Nc2ccc([C@@H]3c4[nH]c5c(F)cccc5c4C[C@@H](C)N3CC(F)(F)CO)cc2)C1 |
| InChI | InChI=1S/C28H35F3N4O/c1-3-4-12-34-14-21(15-34)32-20-10-8-19(9-11-20)27-26-23(22-6-5-7-24(29)25(22)33-26)13-18(2)35(27)16-28(30,31)17-36/h5-11,18,21,27,32-33,36H,3-4,12-17H2,1-2H3/t18-,27-/m1/s1 |
| InChIKey | OMMLAPKRWIFMRI-DNOBIOAJSA-N |
| XLogP | 5.17 |
| TPSA | 54.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.61 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|