C26H26N6O3S — CID 163612282
3-[5-(1,3-diiminopropan-2-yl)-1,3-thiazol-2-yl]-N-[(1R)-1-(5-ethenylpyrazin-2-yl)prop-2-enyl]-5-[(3S)-oxolan-3-yl]oxybenzamide (PubChem CID 163612282) has the molecular formula C26H26N6O3S and a molecular weight of 502.60 g/mol. Its IUPAC name is 3-[5-(1,3-diiminopropan-2-yl)-1,3-thiazol-2-yl]-N-[(1R)-1-(5-ethenylpyrazin-2-yl)prop-2-enyl]-5-[(3S)-oxolan-3-yl]oxybenzamide.
| Compound Name | 3-[5-(1,3-diiminopropan-2-yl)-1,3-thiazol-2-yl]-N-[(1R)-1-(5-ethenylpyrazin-2-yl)prop-2-enyl]-5-[(3S)-oxolan-3-yl]oxybenzamide |
|---|---|
| PubChem CID | 163612282 |
| Molecular Formula | C26H26N6O3S |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | 3-[5-(1,3-diiminopropan-2-yl)-1,3-thiazol-2-yl]-N-[(1R)-1-(5-ethenylpyrazin-2-yl)prop-2-enyl]-5-[(3S)-oxolan-3-yl]oxybenzamide |
| SMILES | [H]/N=C/C(/C=N/[H])c1cnc(-c2cc(O[C@H]3CCOC3)cc(C(=O)N[C@H](C=C)c3cnc(C=C)cn3)c2)s1 |
| InChI | InChI=1S/C26H26N6O3S/c1-3-19-12-30-23(13-29-19)22(4-2)32-25(33)16-7-17(9-21(8-16)35-20-5-6-34-15-20)26-31-14-24(36-26)18(10-27)11-28/h3-4,7-14,18,20,22,27-28H,1-2,5-6,15H2,(H,32,33)/b27-10+,28-11+/t20-,22+/m0/s1 |
| InChIKey | HGZFTOVQSNJOKL-DWQNBVMPSA-N |
| XLogP | 4.45 |
| TPSA | 133.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|