About (Z,3S)-3-ethoxybut-1-ene-1,2-diamine
(Z,3S)-3-ethoxybut-1-ene-1,2-diamine (PubChem CID 163612548) has the molecular formula C6H14N2O
and a molecular weight of 130.19 g/mol. Its IUPAC name is (Z,3S)-3-ethoxybut-1-ene-1,2-diamine.
Molecular Properties
| Compound Name | (Z,3S)-3-ethoxybut-1-ene-1,2-diamine |
| PubChem CID | 163612548 |
| Molecular Formula | C6H14N2O |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.11 |
| IUPAC Name | (Z,3S)-3-ethoxybut-1-ene-1,2-diamine |
| SMILES | CCO[C@@H](C)/C(N)=C/N |
| InChI | InChI=1S/C6H14N2O/c1-3-9-5(2)6(8)4-7/h4-5H,3,7-8H2,1-2H3/b6-4-/t5-/m0/s1 |
| InChIKey | HHEMBUKSTTVCHO-YIWIKUPCSA-N |
| XLogP | 0.17 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (Z,3S)-3-ethoxybut-1-ene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,3S)-3-ethoxybut-1-ene-1,2-diamine?
The IUPAC name of (Z,3S)-3-ethoxybut-1-ene-1,2-diamine (CID 163612548) is (Z,3S)-3-ethoxybut-1-ene-1,2-diamine.
What is the SMILES notation for (Z,3S)-3-ethoxybut-1-ene-1,2-diamine?
The canonical SMILES for (Z,3S)-3-ethoxybut-1-ene-1,2-diamine is CCO[C@@H](C)/C(N)=C/N.
What is the InChIKey of (Z,3S)-3-ethoxybut-1-ene-1,2-diamine?
The InChIKey is HHEMBUKSTTVCHO-YIWIKUPCSA-N. The full InChI is InChI=1S/C6H14N2O/c1-3-9-5(2)6(8)4-7/h4-5H,3,7-8H2,1-2H3/b6-4-/t5-/m0/s1.
What are the key properties of (Z,3S)-3-ethoxybut-1-ene-1,2-diamine?
(Z,3S)-3-ethoxybut-1-ene-1,2-diamine has a molecular weight of 130.19 g/mol, XLogP of 0.17, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,3S)-3-ethoxybut-1-ene-1,2-diamine is sourced from PubChem (CID 163612548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).