C18H20N4O4 — CID 163612764
N-[1,3-benzodioxol-5-yl(methoxy)methyl]-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-3-amine (PubChem CID 163612764) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is N-[1,3-benzodioxol-5-yl(methoxy)methyl]-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-3-amine.
| Compound Name | N-[1,3-benzodioxol-5-yl(methoxy)methyl]-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-3-amine |
|---|---|
| PubChem CID | 163612764 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | N-[1,3-benzodioxol-5-yl(methoxy)methyl]-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-3-amine |
| SMILES | COC(Nc1ccn(Cc2c(C)noc2C)n1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H20N4O4/c1-11-14(12(2)26-21-11)9-22-7-6-17(20-22)19-18(23-3)13-4-5-15-16(8-13)25-10-24-15/h4-8,18H,9-10H2,1-3H3,(H,19,20) |
| InChIKey | HHIUBJBRMOMTKW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 83.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|