C8H13F3N2 — CID 163612816
(1Z,3Z)-6,6,6-trifluoro-2-N,5-dimethylhexa-1,3-diene-1,2-diamine (PubChem CID 163612816) has the molecular formula C8H13F3N2 and a molecular weight of 194.20 g/mol. Its IUPAC name is (1Z,3Z)-6,6,6-trifluoro-2-N,5-dimethylhexa-1,3-diene-1,2-diamine.
| Compound Name | (1Z,3Z)-6,6,6-trifluoro-2-N,5-dimethylhexa-1,3-diene-1,2-diamine |
|---|---|
| PubChem CID | 163612816 |
| Molecular Formula | C8H13F3N2 |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | (1Z,3Z)-6,6,6-trifluoro-2-N,5-dimethylhexa-1,3-diene-1,2-diamine |
| SMILES | CNC(/C=C\C(C)C(F)(F)F)=C\N |
| InChI | InChI=1S/C8H13F3N2/c1-6(8(9,10)11)3-4-7(5-12)13-2/h3-6,13H,12H2,1-2H3/b4-3-,7-5- |
| InChIKey | HHKAXRLUBSWAOH-MRWCJKGFSA-N |
| XLogP | 1.76 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|