C14H21N6P — CID 163613511
3-amino-N-(aminomethylidene)-N'-methyl-2-(C-phosphanylcarbonimidoyl)-3-(2,3,4,5-tetrahydro-1H-indol-2-yl)prop-2-enimidamide (PubChem CID 163613511) has the molecular formula C14H21N6P and a molecular weight of 304.34 g/mol. Its IUPAC name is 3-amino-N-(aminomethylidene)-N'-methyl-2-(C-phosphanylcarbonimidoyl)-3-(2,3,4,5-tetrahydro-1H-indol-2-yl)prop-2-enimidamide.
| Compound Name | 3-amino-N-(aminomethylidene)-N'-methyl-2-(C-phosphanylcarbonimidoyl)-3-(2,3,4,5-tetrahydro-1H-indol-2-yl)prop-2-enimidamide |
|---|---|
| PubChem CID | 163613511 |
| Molecular Formula | C14H21N6P |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 3-amino-N-(aminomethylidene)-N'-methyl-2-(C-phosphanylcarbonimidoyl)-3-(2,3,4,5-tetrahydro-1H-indol-2-yl)prop-2-enimidamide |
| SMILES | [H]/N=C(\P)C(=C(N)C1CC2=C(C=CCC2)N1)C(=N/C)/N=C/N |
| InChI | InChI=1S/C14H21N6P/c1-18-14(19-7-15)11(13(17)21)12(16)10-6-8-4-2-3-5-9(8)20-10/h3,5,7,10,17,20H,2,4,6,16,21H2,1H3,(H2,15,18,19)/b12-11?,17-13- |
| InChIKey | JGMAVIAWGQHGGP-PSUNCBPWSA-N |
| XLogP | 1.03 |
| TPSA | 112.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|