C48H32N8O — CID 163614175
5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-[3-(4-naphthalen-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-2,3-dihydro-1,3,4-oxadiazole (PubChem CID 163614175) has the molecular formula C48H32N8O and a molecular weight of 736.84 g/mol. Its IUPAC name is 5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-[3-(4-naphthalen-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-2,3-dihydro-1,3,4-oxadiazole.
| Compound Name | 5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-[3-(4-naphthalen-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-2,3-dihydro-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 163614175 |
| Molecular Formula | C48H32N8O |
| Molecular Weight | 736.84 g/mol |
| Exact Mass | 736.27 |
| IUPAC Name | 5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-[3-(4-naphthalen-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-2,3-dihydro-1,3,4-oxadiazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(C4=NNC(c5cccc(-c6nc(-c7ccccc7)nc(-c7cccc8ccccc78)n6)c5)O4)cc3)n2)cc1 |
| InChI | InChI=1S/C48H32N8O/c1-4-15-32(16-5-1)41-49-42(33-17-6-2-7-18-33)51-44(50-41)35-26-28-36(29-27-35)47-55-56-48(57-47)38-23-12-22-37(30-38)45-52-43(34-19-8-3-9-20-34)53-46(54-45)40-25-13-21-31-14-10-11-24-39(31)40/h1-30,48,56H |
| InChIKey | HINWSQUOWYLGEZ-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.84 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |