C9H11N — CID 163614673
1,5,6,8a-tetrahydroisoquinoline (PubChem CID 163614673) has the molecular formula C9H11N and a molecular weight of 133.19 g/mol. Its IUPAC name is 1,5,6,8a-tetrahydroisoquinoline.
| Compound Name | 1,5,6,8a-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 163614673 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 1,5,6,8a-tetrahydroisoquinoline |
| SMILES | C1=CC2CN=CC=C2CC1 |
| InChI | InChI=1S/C9H11N/c1-2-4-9-7-10-6-5-8(9)3-1/h2,4-6,9H,1,3,7H2 |
| InChIKey | HIYPHEDXHXFGPU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|