C12H14N2O — CID 163616268
5,8-dimethyl-6-(methylamino)-2H-isoquinolin-1-one (PubChem CID 163616268) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 5,8-dimethyl-6-(methylamino)-2H-isoquinolin-1-one.
| Compound Name | 5,8-dimethyl-6-(methylamino)-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 163616268 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 5,8-dimethyl-6-(methylamino)-2H-isoquinolin-1-one |
| SMILES | CNc1cc(C)c2c(=O)[nH]ccc2c1C |
| InChI | InChI=1S/C12H14N2O/c1-7-6-10(13-3)8(2)9-4-5-14-12(15)11(7)9/h4-6,13H,1-3H3,(H,14,15) |
| InChIKey | HKHFLLGQEVXHBN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |