About 1-bromo-2-(2,2-dimethylpropyl)benzene-4-ide;carbanide;uranium(2+)
1-bromo-2-(2,2-dimethylpropyl)benzene-4-ide;carbanide;uranium(2+) (PubChem CID 163616317) has the molecular formula C12H17BrU
and a molecular weight of 479.20 g/mol. Its IUPAC name is 1-bromo-2-(2,2-dimethylpropyl)benzene-4-ide;carbanide;uranium(2+).
Molecular Properties
| Compound Name | 1-bromo-2-(2,2-dimethylpropyl)benzene-4-ide;carbanide;uranium(2+) |
| PubChem CID | 163616317 |
| Molecular Formula | C12H17BrU |
| Molecular Weight | 479.20 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 1-bromo-2-(2,2-dimethylpropyl)benzene-4-ide;carbanide;uranium(2+) |
| SMILES | CC(C)(C)Cc1c[c-]ccc1Br.[CH3-].[U+2] |
| InChI | InChI=1S/C11H14Br.CH3.U/c1-11(2,3)8-9-6-4-5-7-10(9)12;;/h5-7H,8H2,1-3H3;1H3;/q2*-1;+2 |
| InChIKey | DXVYRHMGBWBVSW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 479.20 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2-(2,2-dimethylpropyl)benzene-4-ide;carbanide;uranium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-(2,2-dimethylpropyl)benzene-4-ide;carbanide;uranium(2+)?
The IUPAC name of 1-bromo-2-(2,2-dimethylpropyl)benzene-4-ide;carbanide;uranium(2+) (CID 163616317) is 1-bromo-2-(2,2-dimethylpropyl)benzene-4-ide;carbanide;uranium(2+).
What is the SMILES notation for 1-bromo-2-(2,2-dimethylpropyl)benzene-4-ide;carbanide;uranium(2+)?
The canonical SMILES for 1-bromo-2-(2,2-dimethylpropyl)benzene-4-ide;carbanide;uranium(2+) is CC(C)(C)Cc1c[c-]ccc1Br.[CH3-].[U+2].
What is the InChIKey of 1-bromo-2-(2,2-dimethylpropyl)benzene-4-ide;carbanide;uranium(2+)?
The InChIKey is DXVYRHMGBWBVSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14Br.CH3.U/c1-11(2,3)8-9-6-4-5-7-10(9)12;;/h5-7H,8H2,1-3H3;1H3;/q2*-1;+2.
What are the key properties of 1-bromo-2-(2,2-dimethylpropyl)benzene-4-ide;carbanide;uranium(2+)?
1-bromo-2-(2,2-dimethylpropyl)benzene-4-ide;carbanide;uranium(2+) has a molecular weight of 479.20 g/mol, XLogP of 4.29, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-(2,2-dimethylpropyl)benzene-4-ide;carbanide;uranium(2+) is sourced from PubChem (CID 163616317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).