C41H86O9Si2 — CID 163616355
3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propyl 2,2-dimethylbutanoate;2-(2-ethoxyethoxy)ethyl 2-methylbutanoate;2-ethylhexyl 2-methylbutanoate (PubChem CID 163616355) has the molecular formula C41H86O9Si2 and a molecular weight of 779.30 g/mol. Its IUPAC name is 3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propyl 2,2-dimethylbutanoate;2-(2-ethoxyethoxy)ethyl 2-methylbutanoate;2-ethylhexyl 2-methylbutanoate.
| Compound Name | 3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propyl 2,2-dimethylbutanoate;2-(2-ethoxyethoxy)ethyl 2-methylbutanoate;2-ethylhexyl 2-methylbutanoate |
|---|---|
| PubChem CID | 163616355 |
| Molecular Formula | C41H86O9Si2 |
| Molecular Weight | 779.30 g/mol |
| Exact Mass | 778.58 |
| IUPAC Name | 3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propyl 2,2-dimethylbutanoate;2-(2-ethoxyethoxy)ethyl 2-methylbutanoate;2-ethylhexyl 2-methylbutanoate |
| SMILES | CCCCC(CC)COC(=O)C(C)CC.CCCC[Si](C)(C)O[Si](C)(C)CCCOC(=O)C(C)(C)CC.CCOCCOCCOC(=O)C(C)CC |
| InChI | InChI=1S/C17H38O3Si2.C13H26O2.C11H22O4/c1-9-11-14-21(5,6)20-22(7,8)15-12-13-19-16(18)17(3,4)10-2;1-5-8-9-12(7-3)10-15-13(14)11(4)6-2;1-4-10(3)11(12)15-9-8-14-7-6-13-5-2/h9-15H2,1-8H3;11-12H,5-10H2,1-4H3;10H,4-9H2,1-3H3 |
| InChIKey | HKJDASHYMLSQBH-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.30 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|