C21H22N2 — CID 163616793
N-[(1E,3E)-4-(7,8-dihydroisoquinolin-1-yl)hexa-1,3-dienyl]aniline (PubChem CID 163616793) has the molecular formula C21H22N2 and a molecular weight of 302.42 g/mol. Its IUPAC name is N-[(1E,3E)-4-(7,8-dihydroisoquinolin-1-yl)hexa-1,3-dienyl]aniline.
| Compound Name | N-[(1E,3E)-4-(7,8-dihydroisoquinolin-1-yl)hexa-1,3-dienyl]aniline |
|---|---|
| PubChem CID | 163616793 |
| Molecular Formula | C21H22N2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | N-[(1E,3E)-4-(7,8-dihydroisoquinolin-1-yl)hexa-1,3-dienyl]aniline |
| SMILES | CC/C(=C\C=C\Nc1ccccc1)c1nccc2c1CCC=C2 |
| InChI | InChI=1S/C21H22N2/c1-2-17(10-8-15-22-19-11-4-3-5-12-19)21-20-13-7-6-9-18(20)14-16-23-21/h3-6,8-12,14-16,22H,2,7,13H2,1H3/b15-8+,17-10+ |
| InChIKey | HKRDVVPMTRVALD-SOWNIVKUSA-N |
| XLogP | 5.46 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|