C19H19ClF3N3O3S — CID 163618073
1-[2-chloro-4-(sulfinoamino)benzoyl]-2-methyl-4-[(2,4,6-trifluorophenyl)methyl]piperazine (PubChem CID 163618073) has the molecular formula C19H19ClF3N3O3S and a molecular weight of 461.89 g/mol. Its IUPAC name is 1-[2-chloro-4-(sulfinoamino)benzoyl]-2-methyl-4-[(2,4,6-trifluorophenyl)methyl]piperazine.
| Compound Name | 1-[2-chloro-4-(sulfinoamino)benzoyl]-2-methyl-4-[(2,4,6-trifluorophenyl)methyl]piperazine |
|---|---|
| PubChem CID | 163618073 |
| Molecular Formula | C19H19ClF3N3O3S |
| Molecular Weight | 461.89 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 1-[2-chloro-4-(sulfinoamino)benzoyl]-2-methyl-4-[(2,4,6-trifluorophenyl)methyl]piperazine |
| SMILES | CC1CN(Cc2c(F)cc(F)cc2F)CCN1C(=O)c1ccc(NS(=O)O)cc1Cl |
| InChI | InChI=1S/C19H19ClF3N3O3S/c1-11-9-25(10-15-17(22)6-12(21)7-18(15)23)4-5-26(11)19(27)14-3-2-13(8-16(14)20)24-30(28)29/h2-3,6-8,11,24H,4-5,9-10H2,1H3,(H,28,29) |
| InChIKey | SRULKSJQSZFXPE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.89 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|