About [1-(1,1-dioxothian-4-yl)-3-(trifluoromethoxy)propan-2-yl] propanoate
[1-(1,1-dioxothian-4-yl)-3-(trifluoromethoxy)propan-2-yl] propanoate (PubChem CID 163618576) has the molecular formula C12H19F3O5S
and a molecular weight of 332.34 g/mol. Its IUPAC name is [1-(1,1-dioxothian-4-yl)-3-(trifluoromethoxy)propan-2-yl] propanoate.
Molecular Properties
| Compound Name | [1-(1,1-dioxothian-4-yl)-3-(trifluoromethoxy)propan-2-yl] propanoate |
| PubChem CID | 163618576 |
| Molecular Formula | C12H19F3O5S |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | [1-(1,1-dioxothian-4-yl)-3-(trifluoromethoxy)propan-2-yl] propanoate |
| SMILES | CCC(=O)OC(COC(F)(F)F)CC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H19F3O5S/c1-2-11(16)20-10(8-19-12(13,14)15)7-9-3-5-21(17,18)6-4-9/h9-10H,2-8H2,1H3 |
| InChIKey | GEAKMVDMFWKWGD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(1,1-dioxothian-4-yl)-3-(trifluoromethoxy)propan-2-yl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1,1-dioxothian-4-yl)-3-(trifluoromethoxy)propan-2-yl] propanoate?
The IUPAC name of [1-(1,1-dioxothian-4-yl)-3-(trifluoromethoxy)propan-2-yl] propanoate (CID 163618576) is [1-(1,1-dioxothian-4-yl)-3-(trifluoromethoxy)propan-2-yl] propanoate.
What is the SMILES notation for [1-(1,1-dioxothian-4-yl)-3-(trifluoromethoxy)propan-2-yl] propanoate?
The canonical SMILES for [1-(1,1-dioxothian-4-yl)-3-(trifluoromethoxy)propan-2-yl] propanoate is CCC(=O)OC(COC(F)(F)F)CC1CCS(=O)(=O)CC1.
What is the InChIKey of [1-(1,1-dioxothian-4-yl)-3-(trifluoromethoxy)propan-2-yl] propanoate?
The InChIKey is GEAKMVDMFWKWGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19F3O5S/c1-2-11(16)20-10(8-19-12(13,14)15)7-9-3-5-21(17,18)6-4-9/h9-10H,2-8H2,1H3.
What are the key properties of [1-(1,1-dioxothian-4-yl)-3-(trifluoromethoxy)propan-2-yl] propanoate?
[1-(1,1-dioxothian-4-yl)-3-(trifluoromethoxy)propan-2-yl] propanoate has a molecular weight of 332.34 g/mol, XLogP of 2.06, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1,1-dioxothian-4-yl)-3-(trifluoromethoxy)propan-2-yl] propanoate is sourced from PubChem (CID 163618576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).