C13H19F5O5S — CID 163618577
[1-(1,1-dioxothian-4-yl)-3-(1,1,2,2,2-pentafluoroethoxy)propan-2-yl] propanoate (PubChem CID 163618577) has the molecular formula C13H19F5O5S and a molecular weight of 382.35 g/mol. Its IUPAC name is [1-(1,1-dioxothian-4-yl)-3-(1,1,2,2,2-pentafluoroethoxy)propan-2-yl] propanoate.
| Compound Name | [1-(1,1-dioxothian-4-yl)-3-(1,1,2,2,2-pentafluoroethoxy)propan-2-yl] propanoate |
|---|---|
| PubChem CID | 163618577 |
| Molecular Formula | C13H19F5O5S |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | [1-(1,1-dioxothian-4-yl)-3-(1,1,2,2,2-pentafluoroethoxy)propan-2-yl] propanoate |
| SMILES | CCC(=O)OC(COC(F)(F)C(F)(F)F)CC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C13H19F5O5S/c1-2-11(19)23-10(8-22-13(17,18)12(14,15)16)7-9-3-5-24(20,21)6-4-9/h9-10H,2-8H2,1H3 |
| InChIKey | YPDCEWJZXPXSAX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|