C14H22F4O5S — CID 163618578
[1-(1,1-dioxothian-4-yl)-3-(1,1,2,2-tetrafluoropropoxy)propan-2-yl] propanoate (PubChem CID 163618578) has the molecular formula C14H22F4O5S and a molecular weight of 378.38 g/mol. Its IUPAC name is [1-(1,1-dioxothian-4-yl)-3-(1,1,2,2-tetrafluoropropoxy)propan-2-yl] propanoate.
| Compound Name | [1-(1,1-dioxothian-4-yl)-3-(1,1,2,2-tetrafluoropropoxy)propan-2-yl] propanoate |
|---|---|
| PubChem CID | 163618578 |
| Molecular Formula | C14H22F4O5S |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | [1-(1,1-dioxothian-4-yl)-3-(1,1,2,2-tetrafluoropropoxy)propan-2-yl] propanoate |
| SMILES | CCC(=O)OC(COC(F)(F)C(C)(F)F)CC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C14H22F4O5S/c1-3-12(19)23-11(9-22-14(17,18)13(2,15)16)8-10-4-6-24(20,21)7-5-10/h10-11H,3-9H2,1-2H3 |
| InChIKey | BWWWYDQKOKBVGC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|