C24H41F2N7O2 — CID 163618821
3,3-diamino-N-[4-[(8aR)-6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl]-5-fluoropiperidin-3-yl]-2-(3-fluoro-6,6-dimethyl-3,4,5,7-tetrahydro-2H-azocin-8-yl)propanamide (PubChem CID 163618821) has the molecular formula C24H41F2N7O2 and a molecular weight of 497.64 g/mol. Its IUPAC name is 3,3-diamino-N-[4-[(8aR)-6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl]-5-fluoropiperidin-3-yl]-2-(3-fluoro-6,6-dimethyl-3,4,5,7-tetrahydro-2H-azocin-8-yl)propanamide.
| Compound Name | 3,3-diamino-N-[4-[(8aR)-6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl]-5-fluoropiperidin-3-yl]-2-(3-fluoro-6,6-dimethyl-3,4,5,7-tetrahydro-2H-azocin-8-yl)propanamide |
|---|---|
| PubChem CID | 163618821 |
| Molecular Formula | C24H41F2N7O2 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.33 |
| IUPAC Name | 3,3-diamino-N-[4-[(8aR)-6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl]-5-fluoropiperidin-3-yl]-2-(3-fluoro-6,6-dimethyl-3,4,5,7-tetrahydro-2H-azocin-8-yl)propanamide |
| SMILES | CC1(C)CCC(F)C/N=C(/C(C(=O)NC2CNCC(F)C2N2CCN3C(=O)CC[C@@H]3C2)C(N)N)C1 |
| InChI | InChI=1S/C24H41F2N7O2/c1-24(2)6-5-14(25)10-30-17(9-24)20(22(27)28)23(35)31-18-12-29-11-16(26)21(18)32-7-8-33-15(13-32)3-4-19(33)34/h14-16,18,20-22,29H,3-13,27-28H2,1-2H3,(H,31,35)/b30-17+/t14?,15-,16?,18?,20?,21?/m1/s1 |
| InChIKey | HMIIQUZVCYUAAD-OCNCJLJTSA-N |
| XLogP | -0.06 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|