C24H24F3NO4S — CID 163619482
(1S,8R,9R,10S)-3,4-dihydroxy-12-methoxy-16-methyl-8-[4-(trifluoromethyl)phenyl]sulfanyl-16-azatetracyclo[7.5.2.01,10.02,7]hexadeca-2(7),3,11-trien-13-one (PubChem CID 163619482) has the molecular formula C24H24F3NO4S and a molecular weight of 479.52 g/mol. Its IUPAC name is (1S,8R,9R,10S)-3,4-dihydroxy-12-methoxy-16-methyl-8-[4-(trifluoromethyl)phenyl]sulfanyl-16-azatetracyclo[7.5.2.01,10.02,7]hexadeca-2(7),3,11-trien-13-one.
| Compound Name | (1S,8R,9R,10S)-3,4-dihydroxy-12-methoxy-16-methyl-8-[4-(trifluoromethyl)phenyl]sulfanyl-16-azatetracyclo[7.5.2.01,10.02,7]hexadeca-2(7),3,11-trien-13-one |
|---|---|
| PubChem CID | 163619482 |
| Molecular Formula | C24H24F3NO4S |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | (1S,8R,9R,10S)-3,4-dihydroxy-12-methoxy-16-methyl-8-[4-(trifluoromethyl)phenyl]sulfanyl-16-azatetracyclo[7.5.2.01,10.02,7]hexadeca-2(7),3,11-trien-13-one |
| SMILES | COC1=C[C@@H]2[C@@H]3[C@H](Sc4ccc(C(F)(F)F)cc4)C4=C(C(O)=C(O)CC4)[C@@]2(CC1=O)CN3C |
| InChI | InChI=1S/C24H24F3NO4S/c1-28-11-23-10-17(30)18(32-2)9-15(23)20(28)22(14-7-8-16(29)21(31)19(14)23)33-13-5-3-12(4-6-13)24(25,26)27/h3-6,9,15,20,22,29,31H,7-8,10-11H2,1-2H3/t15-,20-,22-,23+/m1/s1 |
| InChIKey | HMWNOOCKXJAETI-ICYYRSKXSA-N |
| XLogP | 5.02 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |