C9H16IN5 — CID 163619572
2-[amino-[(3-iodocyclohexa-1,5-dien-1-yl)methylamino]methyl]guanidine (PubChem CID 163619572) has the molecular formula C9H16IN5 and a molecular weight of 321.17 g/mol. Its IUPAC name is 2-[amino-[(3-iodocyclohexa-1,5-dien-1-yl)methylamino]methyl]guanidine.
| Compound Name | 2-[amino-[(3-iodocyclohexa-1,5-dien-1-yl)methylamino]methyl]guanidine |
|---|---|
| PubChem CID | 163619572 |
| Molecular Formula | C9H16IN5 |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 2-[amino-[(3-iodocyclohexa-1,5-dien-1-yl)methylamino]methyl]guanidine |
| SMILES | NC(N)=NC(N)NCC1=CC(I)CC=C1 |
| InChI | InChI=1S/C9H16IN5/c10-7-3-1-2-6(4-7)5-14-9(13)15-8(11)12/h1-2,4,7,9,14H,3,5,13H2,(H4,11,12,15) |
| InChIKey | HMYHXIMAHBKUJE-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 102.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|