C20H24N4O3 — CID 163621131
ethyl (E)-3-[4-[[3-(diaminomethylideneamino)benzoyl]amino]-2-methylcyclohexa-1,3-dien-1-yl]prop-2-enoate (PubChem CID 163621131) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is ethyl (E)-3-[4-[[3-(diaminomethylideneamino)benzoyl]amino]-2-methylcyclohexa-1,3-dien-1-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[[3-(diaminomethylideneamino)benzoyl]amino]-2-methylcyclohexa-1,3-dien-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 163621131 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | ethyl (E)-3-[4-[[3-(diaminomethylideneamino)benzoyl]amino]-2-methylcyclohexa-1,3-dien-1-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/C1=C(C)C=C(NC(=O)c2cccc(N=C(N)N)c2)CC1 |
| InChI | InChI=1S/C20H24N4O3/c1-3-27-18(25)10-8-14-7-9-17(11-13(14)2)23-19(26)15-5-4-6-16(12-15)24-20(21)22/h4-6,8,10-12H,3,7,9H2,1-2H3,(H,23,26)(H4,21,22,24)/b10-8+ |
| InChIKey | HOERETHVBBITTG-CSKARUKUSA-N |
| XLogP | 2.43 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|