C18H24F3N3O2 — CID 163621255
[(3S,4S)-1-[(1S,4R)-3-amino-4-(2,4,5-trifluorophenyl)cyclohexyl]-4-methylpyrrolidin-3-yl]carbamic acid (PubChem CID 163621255) has the molecular formula C18H24F3N3O2 and a molecular weight of 371.40 g/mol. Its IUPAC name is [(3S,4S)-1-[(1S,4R)-3-amino-4-(2,4,5-trifluorophenyl)cyclohexyl]-4-methylpyrrolidin-3-yl]carbamic acid.
| Compound Name | [(3S,4S)-1-[(1S,4R)-3-amino-4-(2,4,5-trifluorophenyl)cyclohexyl]-4-methylpyrrolidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 163621255 |
| Molecular Formula | C18H24F3N3O2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | [(3S,4S)-1-[(1S,4R)-3-amino-4-(2,4,5-trifluorophenyl)cyclohexyl]-4-methylpyrrolidin-3-yl]carbamic acid |
| SMILES | C[C@H]1CN([C@H]2CC[C@H](c3cc(F)c(F)cc3F)C(N)C2)C[C@H]1NC(=O)O |
| InChI | InChI=1S/C18H24F3N3O2/c1-9-7-24(8-17(9)23-18(25)26)10-2-3-11(16(22)4-10)12-5-14(20)15(21)6-13(12)19/h5-6,9-11,16-17,23H,2-4,7-8,22H2,1H3,(H,25,26)/t9-,10-,11+,16?,17+/m0/s1 |
| InChIKey | HOHFPNKXYNLBSG-TXBXWOEWSA-N |
| XLogP | 2.66 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|