C42H29N3O — CID 163621824
9,9-dimethyl-1-[3-[2-(4-phenylphenyl)quinazolin-4-yl]phenyl]xanthene-2-carbonitrile (PubChem CID 163621824) has the molecular formula C42H29N3O and a molecular weight of 591.71 g/mol. Its IUPAC name is 9,9-dimethyl-1-[3-[2-(4-phenylphenyl)quinazolin-4-yl]phenyl]xanthene-2-carbonitrile.
| Compound Name | 9,9-dimethyl-1-[3-[2-(4-phenylphenyl)quinazolin-4-yl]phenyl]xanthene-2-carbonitrile |
|---|---|
| PubChem CID | 163621824 |
| Molecular Formula | C42H29N3O |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.23 |
| IUPAC Name | 9,9-dimethyl-1-[3-[2-(4-phenylphenyl)quinazolin-4-yl]phenyl]xanthene-2-carbonitrile |
| SMILES | CC1(C)c2ccccc2Oc2ccc(C#N)c(-c3cccc(-c4nc(-c5ccc(-c6ccccc6)cc5)nc5ccccc45)c3)c21 |
| InChI | InChI=1S/C42H29N3O/c1-42(2)34-16-7-9-18-36(34)46-37-24-23-32(26-43)38(39(37)42)30-13-10-14-31(25-30)40-33-15-6-8-17-35(33)44-41(45-40)29-21-19-28(20-22-29)27-11-4-3-5-12-27/h3-25H,1-2H3 |
| InChIKey | HOTFOJKGPYTOOD-UHFFFAOYSA-N |
| XLogP | 10.60 |
| TPSA | 58.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |