C57H45N3 — CID 163623400
2,4-diphenyl-6-[2-[3-[9,9,10,10-tetramethyl-6-(3-phenylphenyl)phenanthren-2-yl]phenyl]phenyl]-1,3,5-triazine (PubChem CID 163623400) has the molecular formula C57H45N3 and a molecular weight of 772.01 g/mol. Its IUPAC name is 2,4-diphenyl-6-[2-[3-[9,9,10,10-tetramethyl-6-(3-phenylphenyl)phenanthren-2-yl]phenyl]phenyl]-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[2-[3-[9,9,10,10-tetramethyl-6-(3-phenylphenyl)phenanthren-2-yl]phenyl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 163623400 |
| Molecular Formula | C57H45N3 |
| Molecular Weight | 772.01 g/mol |
| Exact Mass | 771.36 |
| IUPAC Name | 2,4-diphenyl-6-[2-[3-[9,9,10,10-tetramethyl-6-(3-phenylphenyl)phenanthren-2-yl]phenyl]phenyl]-1,3,5-triazine |
| SMILES | CC1(C)c2ccc(-c3cccc(-c4ccccc4)c3)cc2-c2ccc(-c3cccc(-c4ccccc4-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)cc2C1(C)C |
| InChI | InChI=1S/C57H45N3/c1-56(2)51-33-31-44(42-25-16-24-41(34-42)38-18-8-5-9-19-38)36-50(51)48-32-30-45(37-52(48)57(56,3)4)43-26-17-27-46(35-43)47-28-14-15-29-49(47)55-59-53(39-20-10-6-11-21-39)58-54(60-55)40-22-12-7-13-23-40/h5-37H,1-4H3 |
| InChIKey | AQXTXRFTIHVGPZ-UHFFFAOYSA-N |
| XLogP | 14.78 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.01 |
| LogP ≤ 5 | 14.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |