C8H9N3O3 — CID 163623643
1-(2,6-diamino-3-nitrophenyl)ethanone (PubChem CID 163623643) has the molecular formula C8H9N3O3 and a molecular weight of 195.18 g/mol. Its IUPAC name is 1-(2,6-diamino-3-nitrophenyl)ethanone.
| Compound Name | 1-(2,6-diamino-3-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 163623643 |
| Molecular Formula | C8H9N3O3 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 1-(2,6-diamino-3-nitrophenyl)ethanone |
| SMILES | CC(=O)c1c(N)ccc([N+](=O)[O-])c1N |
| InChI | InChI=1S/C8H9N3O3/c1-4(12)7-5(9)2-3-6(8(7)10)11(13)14/h2-3H,9-10H2,1H3 |
| InChIKey | HQGGMVOPVCONKN-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|