C27H37F3N4O — CID 163624551
(6R)-6-[(1R,3aS,4E,7aR)-4-[2-[5-(3-fluorophenyl)tetrazol-2-yl]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3,3-difluoro-2-methylheptan-2-ol (PubChem CID 163624551) has the molecular formula C27H37F3N4O and a molecular weight of 490.61 g/mol. Its IUPAC name is (6R)-6-[(1R,3aS,4E,7aR)-4-[2-[5-(3-fluorophenyl)tetrazol-2-yl]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3,3-difluoro-2-methylheptan-2-ol.
| Compound Name | (6R)-6-[(1R,3aS,4E,7aR)-4-[2-[5-(3-fluorophenyl)tetrazol-2-yl]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3,3-difluoro-2-methylheptan-2-ol |
|---|---|
| PubChem CID | 163624551 |
| Molecular Formula | C27H37F3N4O |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | (6R)-6-[(1R,3aS,4E,7aR)-4-[2-[5-(3-fluorophenyl)tetrazol-2-yl]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3,3-difluoro-2-methylheptan-2-ol |
| SMILES | C[C@H](CCC(F)(F)C(C)(C)O)[C@H]1CC[C@H]2/C(=C/Cn3nnc(-c4cccc(F)c4)n3)CCC[C@]12C |
| InChI | InChI=1S/C27H37F3N4O/c1-18(12-15-27(29,30)25(2,3)35)22-10-11-23-19(8-6-14-26(22,23)4)13-16-34-32-24(31-33-34)20-7-5-9-21(28)17-20/h5,7,9,13,17-18,22-23,35H,6,8,10-12,14-16H2,1-4H3/b19-13+/t18-,22-,23+,26-/m1/s1 |
| InChIKey | OHGWRNZQHWLPDD-OUUQHGMRSA-N |
| XLogP | 6.44 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|