C14H12N6O2 — CID 163624701
1-[(4-amino-6-methyl-1,3,5-triazin-2-yl)diazenyl]naphthalene-2,7-diol (PubChem CID 163624701) has the molecular formula C14H12N6O2 and a molecular weight of 296.29 g/mol. Its IUPAC name is 1-[(4-amino-6-methyl-1,3,5-triazin-2-yl)diazenyl]naphthalene-2,7-diol.
| Compound Name | 1-[(4-amino-6-methyl-1,3,5-triazin-2-yl)diazenyl]naphthalene-2,7-diol |
|---|---|
| PubChem CID | 163624701 |
| Molecular Formula | C14H12N6O2 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 1-[(4-amino-6-methyl-1,3,5-triazin-2-yl)diazenyl]naphthalene-2,7-diol |
| SMILES | Cc1nc(N)nc(/N=N/c2c(O)ccc3ccc(O)cc23)n1 |
| InChI | InChI=1S/C14H12N6O2/c1-7-16-13(15)18-14(17-7)20-19-12-10-6-9(21)4-2-8(10)3-5-11(12)22/h2-6,21-22H,1H3,(H2,15,16,17,18)/b20-19+ |
| InChIKey | MMSLPYUTPFMGGV-FMQUCBEESA-N |
| XLogP | 2.74 |
| TPSA | 129.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|