C12H15F2N — CID 163625682
(1R)-6,6-difluorotetracyclo[5.3.2.03,9.05,9]dodec-4-en-11-amine (PubChem CID 163625682) has the molecular formula C12H15F2N and a molecular weight of 211.25 g/mol. Its IUPAC name is (1R)-6,6-difluorotetracyclo[5.3.2.03,9.05,9]dodec-4-en-11-amine.
| Compound Name | (1R)-6,6-difluorotetracyclo[5.3.2.03,9.05,9]dodec-4-en-11-amine |
|---|---|
| PubChem CID | 163625682 |
| Molecular Formula | C12H15F2N |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | (1R)-6,6-difluorotetracyclo[5.3.2.03,9.05,9]dodec-4-en-11-amine |
| SMILES | NC1CC2CC34C[C@H]1CC3C=C4C2(F)F |
| InChI | InChI=1S/C12H15F2N/c13-12(14)8-2-9(15)6-1-7-3-10(12)11(7,4-6)5-8/h3,6-9H,1-2,4-5,15H2/t6-,7?,8?,9?,11?/m1/s1 |
| InChIKey | HRUWKHLICVMFGO-AKRAKMDVSA-N |
| XLogP | 2.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|