About (1E)-1-[ethyl(methyl)-λ4-sulfanylidene]ethanamine
(1E)-1-[ethyl(methyl)-λ4-sulfanylidene]ethanamine (PubChem CID 163626887) has the molecular formula C5H13NS
and a molecular weight of 119.23 g/mol. Its IUPAC name is (1E)-1-[ethyl(methyl)-λ4-sulfanylidene]ethanamine.
Molecular Properties
| Compound Name | (1E)-1-[ethyl(methyl)-λ4-sulfanylidene]ethanamine |
| PubChem CID | 163626887 |
| Molecular Formula | C5H13NS |
| Molecular Weight | 119.23 g/mol |
| Exact Mass | 119.08 |
| IUPAC Name | (1E)-1-[ethyl(methyl)-λ4-sulfanylidene]ethanamine |
| SMILES | CC/S(C)=C(\C)N |
| InChI | InChI=1S/C5H13NS/c1-4-7(3)5(2)6/h4,6H2,1-3H3 |
| InChIKey | HSTXWWSOEVEMAE-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (1E)-1-[ethyl(methyl)-λ4-sulfanylidene]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-[ethyl(methyl)-λ4-sulfanylidene]ethanamine?
The IUPAC name of (1E)-1-[ethyl(methyl)-λ4-sulfanylidene]ethanamine (CID 163626887) is (1E)-1-[ethyl(methyl)-λ4-sulfanylidene]ethanamine.
What is the SMILES notation for (1E)-1-[ethyl(methyl)-λ4-sulfanylidene]ethanamine?
The canonical SMILES for (1E)-1-[ethyl(methyl)-λ4-sulfanylidene]ethanamine is CC/S(C)=C(\C)N.
What is the InChIKey of (1E)-1-[ethyl(methyl)-λ4-sulfanylidene]ethanamine?
The InChIKey is HSTXWWSOEVEMAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NS/c1-4-7(3)5(2)6/h4,6H2,1-3H3.
What are the key properties of (1E)-1-[ethyl(methyl)-λ4-sulfanylidene]ethanamine?
(1E)-1-[ethyl(methyl)-λ4-sulfanylidene]ethanamine has a molecular weight of 119.23 g/mol, XLogP of 1.01, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-[ethyl(methyl)-λ4-sulfanylidene]ethanamine is sourced from PubChem (CID 163626887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).