About CID 163626927
CID 163626927 (PubChem CID 163626927) has the molecular formula C19H27N2O4S+
and a molecular weight of 379.50 g/mol.
Molecular Properties
| Compound Name | CID 163626927 |
| PubChem CID | 163626927 |
| Molecular Formula | C19H27N2O4S+ |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | — |
| SMILES | COC(=O)C[S+](=O)(O)c1ccc2c(c1)nc(CC(C)(C)C)n2CC1CC1 |
| InChI | InChI=1S/C19H26N2O4S/c1-19(2,3)10-17-20-15-9-14(26(23,24)12-18(22)25-4)7-8-16(15)21(17)11-13-5-6-13/h7-9,13H,5-6,10-12H2,1-4H3/p+1 |
| InChIKey | HSURBPRDTNPZES-UHFFFAOYSA-O |
| XLogP | 3.54 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze CID 163626927 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163626927?
The IUPAC name of CID 163626927 (CID 163626927) is not available.
What is the SMILES notation for CID 163626927?
The canonical SMILES for CID 163626927 is COC(=O)C[S+](=O)(O)c1ccc2c(c1)nc(CC(C)(C)C)n2CC1CC1.
What is the InChIKey of CID 163626927?
The InChIKey is HSURBPRDTNPZES-UHFFFAOYSA-O. The full InChI is InChI=1S/C19H26N2O4S/c1-19(2,3)10-17-20-15-9-14(26(23,24)12-18(22)25-4)7-8-16(15)21(17)11-13-5-6-13/h7-9,13H,5-6,10-12H2,1-4H3/p+1.
What are the key properties of CID 163626927?
CID 163626927 has a molecular weight of 379.50 g/mol, XLogP of 3.54, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163626927 is sourced from PubChem (CID 163626927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).