C24H26FIN5S- — CID 163627096
CID 163627096 (PubChem CID 163627096) has the molecular formula C24H26FIN5S- and a molecular weight of 562.48 g/mol.
| Compound Name | CID 163627096 |
|---|---|
| PubChem CID | 163627096 |
| Molecular Formula | C24H26FIN5S- |
| Molecular Weight | 562.48 g/mol |
| Exact Mass | 562.09 |
| IUPAC Name | — |
| SMILES | CCc1nc2c(F)cc(N3CC[I-]CC3)cn2c1N(C)c1nc(-c2ccc(C)cc2)cs1 |
| InChI | InChI=1S/C24H26FIN5S/c1-4-20-23(29(3)24-28-21(15-32-24)17-7-5-16(2)6-8-17)31-14-18(13-19(25)22(31)27-20)30-11-9-26-10-12-30/h5-8,13-15H,4,9-12H2,1-3H3/q-1 |
| InChIKey | NOAWTJVIXFALPB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 36.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.48 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|