About 6-methyl-2-azabicyclo[2.2.0]hexa-1,4-diene
6-methyl-2-azabicyclo[2.2.0]hexa-1,4-diene (PubChem CID 163628067) has the molecular formula C6H7N
and a molecular weight of 93.13 g/mol. Its IUPAC name is 6-methyl-2-azabicyclo[2.2.0]hexa-1,4-diene.
Molecular Properties
| Compound Name | 6-methyl-2-azabicyclo[2.2.0]hexa-1,4-diene |
| PubChem CID | 163628067 |
| Molecular Formula | C6H7N |
| Molecular Weight | 93.13 g/mol |
| Exact Mass | 93.06 |
| IUPAC Name | 6-methyl-2-azabicyclo[2.2.0]hexa-1,4-diene |
| SMILES | CC1C=C2CN=C21 |
| InChI | InChI=1S/C6H7N/c1-4-2-5-3-7-6(4)5/h2,4H,3H2,1H3 |
| InChIKey | HTRTZZJYFMADOM-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 93.13 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-methyl-2-azabicyclo[2.2.0]hexa-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-azabicyclo[2.2.0]hexa-1,4-diene?
The IUPAC name of 6-methyl-2-azabicyclo[2.2.0]hexa-1,4-diene (CID 163628067) is 6-methyl-2-azabicyclo[2.2.0]hexa-1,4-diene.
What is the SMILES notation for 6-methyl-2-azabicyclo[2.2.0]hexa-1,4-diene?
The canonical SMILES for 6-methyl-2-azabicyclo[2.2.0]hexa-1,4-diene is CC1C=C2CN=C21.
What is the InChIKey of 6-methyl-2-azabicyclo[2.2.0]hexa-1,4-diene?
The InChIKey is HTRTZZJYFMADOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N/c1-4-2-5-3-7-6(4)5/h2,4H,3H2,1H3.
What are the key properties of 6-methyl-2-azabicyclo[2.2.0]hexa-1,4-diene?
6-methyl-2-azabicyclo[2.2.0]hexa-1,4-diene has a molecular weight of 93.13 g/mol, XLogP of 1.02, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-azabicyclo[2.2.0]hexa-1,4-diene is sourced from PubChem (CID 163628067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).