About (4S)-2-cyclopropyl-1,1,1-trifluoro-4-methyliodanuidylhexan-2-ol
(4S)-2-cyclopropyl-1,1,1-trifluoro-4-methyliodanuidylhexan-2-ol (PubChem CID 163628225) has the molecular formula C10H17F3IO-
and a molecular weight of 337.14 g/mol. Its IUPAC name is (4S)-2-cyclopropyl-1,1,1-trifluoro-4-methyliodanuidylhexan-2-ol.
Molecular Properties
| Compound Name | (4S)-2-cyclopropyl-1,1,1-trifluoro-4-methyliodanuidylhexan-2-ol |
| PubChem CID | 163628225 |
| Molecular Formula | C10H17F3IO- |
| Molecular Weight | 337.14 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | (4S)-2-cyclopropyl-1,1,1-trifluoro-4-methyliodanuidylhexan-2-ol |
| SMILES | CC[C@@H](CC(O)(C1CC1)C(F)(F)F)[I-]C |
| InChI | InChI=1S/C10H17F3IO/c1-3-8(14-2)6-9(15,7-4-5-7)10(11,12)13/h7-8,15H,3-6H2,1-2H3/q-1/t8-,9?/m0/s1 |
| InChIKey | XNUJEDJYNKNTEX-IENPIDJESA-N |
| XLogP | -0.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.14 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (4S)-2-cyclopropyl-1,1,1-trifluoro-4-methyliodanuidylhexan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2-cyclopropyl-1,1,1-trifluoro-4-methyliodanuidylhexan-2-ol?
The IUPAC name of (4S)-2-cyclopropyl-1,1,1-trifluoro-4-methyliodanuidylhexan-2-ol (CID 163628225) is (4S)-2-cyclopropyl-1,1,1-trifluoro-4-methyliodanuidylhexan-2-ol.
What is the SMILES notation for (4S)-2-cyclopropyl-1,1,1-trifluoro-4-methyliodanuidylhexan-2-ol?
The canonical SMILES for (4S)-2-cyclopropyl-1,1,1-trifluoro-4-methyliodanuidylhexan-2-ol is CC[C@@H](CC(O)(C1CC1)C(F)(F)F)[I-]C.
What is the InChIKey of (4S)-2-cyclopropyl-1,1,1-trifluoro-4-methyliodanuidylhexan-2-ol?
The InChIKey is XNUJEDJYNKNTEX-IENPIDJESA-N. The full InChI is InChI=1S/C10H17F3IO/c1-3-8(14-2)6-9(15,7-4-5-7)10(11,12)13/h7-8,15H,3-6H2,1-2H3/q-1/t8-,9?/m0/s1.
What are the key properties of (4S)-2-cyclopropyl-1,1,1-trifluoro-4-methyliodanuidylhexan-2-ol?
(4S)-2-cyclopropyl-1,1,1-trifluoro-4-methyliodanuidylhexan-2-ol has a molecular weight of 337.14 g/mol, XLogP of -0.42, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2-cyclopropyl-1,1,1-trifluoro-4-methyliodanuidylhexan-2-ol is sourced from PubChem (CID 163628225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).