About N'-[3-(cyclohexen-1-yl)-4-nitrophenyl]-N'-ethyl-N,N-dimethylethane-1,2-diamine
N'-[3-(cyclohexen-1-yl)-4-nitrophenyl]-N'-ethyl-N,N-dimethylethane-1,2-diamine (PubChem CID 163628535) has the molecular formula C18H27N3O2
and a molecular weight of 317.43 g/mol. Its IUPAC name is N'-[3-(cyclohexen-1-yl)-4-nitrophenyl]-N'-ethyl-N,N-dimethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[3-(cyclohexen-1-yl)-4-nitrophenyl]-N'-ethyl-N,N-dimethylethane-1,2-diamine |
| PubChem CID | 163628535 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | N'-[3-(cyclohexen-1-yl)-4-nitrophenyl]-N'-ethyl-N,N-dimethylethane-1,2-diamine |
| SMILES | CCN(CCN(C)C)c1ccc([N+](=O)[O-])c(C2=CCCCC2)c1 |
| InChI | InChI=1S/C18H27N3O2/c1-4-20(13-12-19(2)3)16-10-11-18(21(22)23)17(14-16)15-8-6-5-7-9-15/h8,10-11,14H,4-7,9,12-13H2,1-3H3 |
| InChIKey | HUBUCDDYGXGAHC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[3-(cyclohexen-1-yl)-4-nitrophenyl]-N'-ethyl-N,N-dimethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[3-(cyclohexen-1-yl)-4-nitrophenyl]-N'-ethyl-N,N-dimethylethane-1,2-diamine?
The IUPAC name of N'-[3-(cyclohexen-1-yl)-4-nitrophenyl]-N'-ethyl-N,N-dimethylethane-1,2-diamine (CID 163628535) is N'-[3-(cyclohexen-1-yl)-4-nitrophenyl]-N'-ethyl-N,N-dimethylethane-1,2-diamine.
What is the SMILES notation for N'-[3-(cyclohexen-1-yl)-4-nitrophenyl]-N'-ethyl-N,N-dimethylethane-1,2-diamine?
The canonical SMILES for N'-[3-(cyclohexen-1-yl)-4-nitrophenyl]-N'-ethyl-N,N-dimethylethane-1,2-diamine is CCN(CCN(C)C)c1ccc([N+](=O)[O-])c(C2=CCCCC2)c1.
What is the InChIKey of N'-[3-(cyclohexen-1-yl)-4-nitrophenyl]-N'-ethyl-N,N-dimethylethane-1,2-diamine?
The InChIKey is HUBUCDDYGXGAHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N3O2/c1-4-20(13-12-19(2)3)16-10-11-18(21(22)23)17(14-16)15-8-6-5-7-9-15/h8,10-11,14H,4-7,9,12-13H2,1-3H3.
What are the key properties of N'-[3-(cyclohexen-1-yl)-4-nitrophenyl]-N'-ethyl-N,N-dimethylethane-1,2-diamine?
N'-[3-(cyclohexen-1-yl)-4-nitrophenyl]-N'-ethyl-N,N-dimethylethane-1,2-diamine has a molecular weight of 317.43 g/mol, XLogP of 3.94, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[3-(cyclohexen-1-yl)-4-nitrophenyl]-N'-ethyl-N,N-dimethylethane-1,2-diamine is sourced from PubChem (CID 163628535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).