C16H35N3O2 — CID 163629273
N-[[4-(1-amino-2-methylpropan-2-yl)oxy-2-methylbutan-2-yl]amino]-N-methylhex-5-en-1-amine oxide (PubChem CID 163629273) has the molecular formula C16H35N3O2 and a molecular weight of 301.48 g/mol. Its IUPAC name is N-[[4-(1-amino-2-methylpropan-2-yl)oxy-2-methylbutan-2-yl]amino]-N-methylhex-5-en-1-amine oxide.
| Compound Name | N-[[4-(1-amino-2-methylpropan-2-yl)oxy-2-methylbutan-2-yl]amino]-N-methylhex-5-en-1-amine oxide |
|---|---|
| PubChem CID | 163629273 |
| Molecular Formula | C16H35N3O2 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.27 |
| IUPAC Name | N-[[4-(1-amino-2-methylpropan-2-yl)oxy-2-methylbutan-2-yl]amino]-N-methylhex-5-en-1-amine oxide |
| SMILES | C=CCCCC[N+](C)([O-])NC(C)(C)CCOC(C)(C)CN |
| InChI | InChI=1S/C16H35N3O2/c1-7-8-9-10-12-19(6,20)18-15(2,3)11-13-21-16(4,5)14-17/h7,18H,1,8-14,17H2,2-6H3 |
| InChIKey | HUQXVVCZCGFRDE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 70.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|