C29H42F6O4S — CID 163630872
(Z,6S)-6-[(1R,3S)-3-[(2S,5S)-3-(benzenesulfonyl)-6,6,6-trifluoro-5-hydroxy-5-methylhexan-2-yl]cyclopentyl]-2-methyl-3-(3,3,3-trifluoropropyl)hept-3-en-2-ol (PubChem CID 163630872) has the molecular formula C29H42F6O4S and a molecular weight of 600.71 g/mol. Its IUPAC name is (Z,6S)-6-[(1R,3S)-3-[(2S,5S)-3-(benzenesulfonyl)-6,6,6-trifluoro-5-hydroxy-5-methylhexan-2-yl]cyclopentyl]-2-methyl-3-(3,3,3-trifluoropropyl)hept-3-en-2-ol.
| Compound Name | (Z,6S)-6-[(1R,3S)-3-[(2S,5S)-3-(benzenesulfonyl)-6,6,6-trifluoro-5-hydroxy-5-methylhexan-2-yl]cyclopentyl]-2-methyl-3-(3,3,3-trifluoropropyl)hept-3-en-2-ol |
|---|---|
| PubChem CID | 163630872 |
| Molecular Formula | C29H42F6O4S |
| Molecular Weight | 600.71 g/mol |
| Exact Mass | 600.27 |
| IUPAC Name | (Z,6S)-6-[(1R,3S)-3-[(2S,5S)-3-(benzenesulfonyl)-6,6,6-trifluoro-5-hydroxy-5-methylhexan-2-yl]cyclopentyl]-2-methyl-3-(3,3,3-trifluoropropyl)hept-3-en-2-ol |
| SMILES | C[C@H](C(C[C@](C)(O)C(F)(F)F)S(=O)(=O)c1ccccc1)[C@H]1CC[C@@H]([C@@H](C)C/C=C(/CCC(F)(F)F)C(C)(C)O)C1 |
| InChI | InChI=1S/C29H42F6O4S/c1-19(11-14-23(26(3,4)36)15-16-28(30,31)32)21-12-13-22(17-21)20(2)25(18-27(5,37)29(33,34)35)40(38,39)24-9-7-6-8-10-24/h6-10,14,19-22,25,36-37H,11-13,15-18H2,1-5H3/b23-14-/t19-,20-,21+,22-,25?,27-/m0/s1 |
| InChIKey | HVYMSCPSOSPOKZ-LGIGVREXSA-N |
| XLogP | 7.65 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.71 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|