C11H20N6O2 — CID 163631258
1-[3-[[3-(2-methoxyethyl)-3-aza-1-azonia-2-azanidacyclopent-4-en-1-yl]methoxy]propyl]triazole (PubChem CID 163631258) has the molecular formula C11H20N6O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 1-[3-[[3-(2-methoxyethyl)-3-aza-1-azonia-2-azanidacyclopent-4-en-1-yl]methoxy]propyl]triazole.
| Compound Name | 1-[3-[[3-(2-methoxyethyl)-3-aza-1-azonia-2-azanidacyclopent-4-en-1-yl]methoxy]propyl]triazole |
|---|---|
| PubChem CID | 163631258 |
| Molecular Formula | C11H20N6O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 1-[3-[[3-(2-methoxyethyl)-3-aza-1-azonia-2-azanidacyclopent-4-en-1-yl]methoxy]propyl]triazole |
| SMILES | COCCN1C=C[NH+](COCCCn2ccnn2)[N-]1 |
| InChI | InChI=1S/C11H20N6O2/c1-18-10-8-16-6-7-17(14-16)11-19-9-2-4-15-5-3-12-13-15/h3,5-7,17H,2,4,8-11H2,1H3 |
| InChIKey | HWGLTVKUAGYDPI-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|