C21H24F2N2O2 — CID 163632810
(3aR,6aS)-5-[(2,4-difluorophenyl)methyl]-2-[2-(5-hydroxy-2-pyridinyl)ethyl]-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-ol (PubChem CID 163632810) has the molecular formula C21H24F2N2O2 and a molecular weight of 374.43 g/mol. Its IUPAC name is (3aR,6aS)-5-[(2,4-difluorophenyl)methyl]-2-[2-(5-hydroxy-2-pyridinyl)ethyl]-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-ol.
| Compound Name | (3aR,6aS)-5-[(2,4-difluorophenyl)methyl]-2-[2-(5-hydroxy-2-pyridinyl)ethyl]-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-ol |
|---|---|
| PubChem CID | 163632810 |
| Molecular Formula | C21H24F2N2O2 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | (3aR,6aS)-5-[(2,4-difluorophenyl)methyl]-2-[2-(5-hydroxy-2-pyridinyl)ethyl]-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-ol |
| SMILES | Oc1ccc(CCN2C[C@@H]3CC(O)(Cc4ccc(F)cc4F)C[C@@H]3C2)nc1 |
| InChI | InChI=1S/C21H24F2N2O2/c22-17-2-1-14(20(23)7-17)8-21(27)9-15-12-25(13-16(15)10-21)6-5-18-3-4-19(26)11-24-18/h1-4,7,11,15-16,26-27H,5-6,8-10,12-13H2/t15-,16+,21? |
| InChIKey | HXOTXWYXUDLOFE-GWTOYCKXSA-N |
| XLogP | 2.92 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |