About 5-iminohexane-2,3-dione
5-iminohexane-2,3-dione (PubChem CID 163632855) has the molecular formula C6H9NO2
and a molecular weight of 127.14 g/mol. Its IUPAC name is 5-iminohexane-2,3-dione.
Molecular Properties
| Compound Name | 5-iminohexane-2,3-dione |
| PubChem CID | 163632855 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | 5-iminohexane-2,3-dione |
| SMILES | [H]/N=C(\C)CC(=O)C(C)=O |
| InChI | InChI=1S/C6H9NO2/c1-4(7)3-6(9)5(2)8/h7H,3H2,1-2H3/b7-4+ |
| InChIKey | HXPRUXNYMSXTPL-QPJJXVBHSA-N |
| XLogP | 0.57 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-iminohexane-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iminohexane-2,3-dione?
The IUPAC name of 5-iminohexane-2,3-dione (CID 163632855) is 5-iminohexane-2,3-dione.
What is the SMILES notation for 5-iminohexane-2,3-dione?
The canonical SMILES for 5-iminohexane-2,3-dione is [H]/N=C(\C)CC(=O)C(C)=O.
What is the InChIKey of 5-iminohexane-2,3-dione?
The InChIKey is HXPRUXNYMSXTPL-QPJJXVBHSA-N. The full InChI is InChI=1S/C6H9NO2/c1-4(7)3-6(9)5(2)8/h7H,3H2,1-2H3/b7-4+.
What are the key properties of 5-iminohexane-2,3-dione?
5-iminohexane-2,3-dione has a molecular weight of 127.14 g/mol, XLogP of 0.57, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iminohexane-2,3-dione is sourced from PubChem (CID 163632855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).