C20H20O7 — CID 163632936
[1,2-bis(4-methoxyphenyl)-2-oxoethyl] 2-acetyloxyacetate (PubChem CID 163632936) has the molecular formula C20H20O7 and a molecular weight of 372.37 g/mol. Its IUPAC name is [1,2-bis(4-methoxyphenyl)-2-oxoethyl] 2-acetyloxyacetate.
| Compound Name | [1,2-bis(4-methoxyphenyl)-2-oxoethyl] 2-acetyloxyacetate |
|---|---|
| PubChem CID | 163632936 |
| Molecular Formula | C20H20O7 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | [1,2-bis(4-methoxyphenyl)-2-oxoethyl] 2-acetyloxyacetate |
| SMILES | COc1ccc(C(=O)C(OC(=O)COC(C)=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C20H20O7/c1-13(21)26-12-18(22)27-20(15-6-10-17(25-3)11-7-15)19(23)14-4-8-16(24-2)9-5-14/h4-11,20H,12H2,1-3H3 |
| InChIKey | HXRIUHXVQUINQJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |