C20H10FI2N3 — CID 163633026
4-fluoro-2,6-bis[2-(3-iodo-4-pyridinyl)ethynyl]aniline (PubChem CID 163633026) has the molecular formula C20H10FI2N3 and a molecular weight of 565.13 g/mol. Its IUPAC name is 4-fluoro-2,6-bis[2-(3-iodo-4-pyridinyl)ethynyl]aniline.
| Compound Name | 4-fluoro-2,6-bis[2-(3-iodo-4-pyridinyl)ethynyl]aniline |
|---|---|
| PubChem CID | 163633026 |
| Molecular Formula | C20H10FI2N3 |
| Molecular Weight | 565.13 g/mol |
| Exact Mass | 564.89 |
| IUPAC Name | 4-fluoro-2,6-bis[2-(3-iodo-4-pyridinyl)ethynyl]aniline |
| SMILES | Nc1c(C#Cc2ccncc2I)cc(F)cc1C#Cc1ccncc1I |
| InChI | InChI=1S/C20H10FI2N3/c21-17-9-15(3-1-13-5-7-25-11-18(13)22)20(24)16(10-17)4-2-14-6-8-26-12-19(14)23/h5-12H,24H2 |
| InChIKey | HXSZUYRYKYVYBS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.13 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|