C17H24N6O — CID 163633950
3-[[(3R,4R)-4-methyl-3-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methoxy]propanenitrile (PubChem CID 163633950) has the molecular formula C17H24N6O and a molecular weight of 328.42 g/mol. Its IUPAC name is 3-[[(3R,4R)-4-methyl-3-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methoxy]propanenitrile.
| Compound Name | 3-[[(3R,4R)-4-methyl-3-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methoxy]propanenitrile |
|---|---|
| PubChem CID | 163633950 |
| Molecular Formula | C17H24N6O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 3-[[(3R,4R)-4-methyl-3-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methoxy]propanenitrile |
| SMILES | C[C@@H]1CCN(COCCC#N)C[C@@H]1N(C)c1ncnc2[nH]ccc12 |
| InChI | InChI=1S/C17H24N6O/c1-13-5-8-23(12-24-9-3-6-18)10-15(13)22(2)17-14-4-7-19-16(14)20-11-21-17/h4,7,11,13,15H,3,5,8-10,12H2,1-2H3,(H,19,20,21)/t13-,15+/m1/s1 |
| InChIKey | HYMGEWOAJPYVFW-HIFRSBDPSA-N |
| XLogP | 1.99 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|