C30H13F15N2O4 — CID 163634021
7-(difluoromethyl)-2,2,3,3,6-pentafluoroinden-1-one;7-(difluoromethyl)-2,2,3,3-tetrafluoro-6-[(5-fluoro-3-pyridinyl)oxy]inden-1-one;5-fluoropyridin-3-ol (PubChem CID 163634021) has the molecular formula C30H13F15N2O4 and a molecular weight of 750.41 g/mol. Its IUPAC name is 7-(difluoromethyl)-2,2,3,3,6-pentafluoroinden-1-one;7-(difluoromethyl)-2,2,3,3-tetrafluoro-6-[(5-fluoro-3-pyridinyl)oxy]inden-1-one;5-fluoropyridin-3-ol.
| Compound Name | 7-(difluoromethyl)-2,2,3,3,6-pentafluoroinden-1-one;7-(difluoromethyl)-2,2,3,3-tetrafluoro-6-[(5-fluoro-3-pyridinyl)oxy]inden-1-one;5-fluoropyridin-3-ol |
|---|---|
| PubChem CID | 163634021 |
| Molecular Formula | C30H13F15N2O4 |
| Molecular Weight | 750.41 g/mol |
| Exact Mass | 750.06 |
| IUPAC Name | 7-(difluoromethyl)-2,2,3,3,6-pentafluoroinden-1-one;7-(difluoromethyl)-2,2,3,3-tetrafluoro-6-[(5-fluoro-3-pyridinyl)oxy]inden-1-one;5-fluoropyridin-3-ol |
| SMILES | O=C1c2c(ccc(F)c2C(F)F)C(F)(F)C1(F)F.O=C1c2c(ccc(Oc3cncc(F)c3)c2C(F)F)C(F)(F)C1(F)F.Oc1cncc(F)c1 |
| InChI | InChI=1S/C15H6F7NO2.C10H3F7O.C5H4FNO/c16-6-3-7(5-23-4-6)25-9-2-1-8-10(11(9)13(17)18)12(24)15(21,22)14(8,19)20;11-4-2-1-3-5(6(4)8(12)13)7(18)10(16,17)9(3,14)15;6-4-1-5(8)3-7-2-4/h1-5,13H;1-2,8H;1-3,8H |
| InChIKey | HYNZSGKBEQTKTN-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.41 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|