C31H37N3O2 — CID 163634057
2-[6-(1,4-dihydrodiazet-4-yl)spiro[1,2,3,4,4a,8a,9a,10a-octahydroxanthene-9,9'-2,3,4,4a,8a,10a-hexahydroxanthene]-3-yl]-2,3-dihydro-1H-pyrrole (PubChem CID 163634057) has the molecular formula C31H37N3O2 and a molecular weight of 483.66 g/mol. Its IUPAC name is 2-[6-(1,4-dihydrodiazet-4-yl)spiro[1,2,3,4,4a,8a,9a,10a-octahydroxanthene-9,9'-2,3,4,4a,8a,10a-hexahydroxanthene]-3-yl]-2,3-dihydro-1H-pyrrole.
| Compound Name | 2-[6-(1,4-dihydrodiazet-4-yl)spiro[1,2,3,4,4a,8a,9a,10a-octahydroxanthene-9,9'-2,3,4,4a,8a,10a-hexahydroxanthene]-3-yl]-2,3-dihydro-1H-pyrrole |
|---|---|
| PubChem CID | 163634057 |
| Molecular Formula | C31H37N3O2 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.29 |
| IUPAC Name | 2-[6-(1,4-dihydrodiazet-4-yl)spiro[1,2,3,4,4a,8a,9a,10a-octahydroxanthene-9,9'-2,3,4,4a,8a,10a-hexahydroxanthene]-3-yl]-2,3-dihydro-1H-pyrrole |
| SMILES | C1=CC2OC3CCCC=C3C3(C2C=C1)C1C=CC(C2C=NN2)=CC1OC1CC(C2CC=CN2)CCC13 |
| InChI | InChI=1S/C31H37N3O2/c1-3-9-27-21(6-1)31(22-7-2-4-10-28(22)35-27)23-13-11-19(25-8-5-15-32-25)16-29(23)36-30-17-20(12-14-24(30)31)26-18-33-34-26/h1,3,5-7,9,12,14-15,17-19,21,23-30,32,34H,2,4,8,10-11,13,16H2 |
| InChIKey | HYPACNTUYPOYLR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|