About 2-amino-3-[[cyclohexyl(methyl)amino]methyl]-5-(methylaminomethyl)cyclohexa-2,4-diene-1-thiol
2-amino-3-[[cyclohexyl(methyl)amino]methyl]-5-(methylaminomethyl)cyclohexa-2,4-diene-1-thiol (PubChem CID 163634676) has the molecular formula C16H29N3S
and a molecular weight of 295.50 g/mol. Its IUPAC name is 2-amino-3-[[cyclohexyl(methyl)amino]methyl]-5-(methylaminomethyl)cyclohexa-2,4-diene-1-thiol.
Molecular Properties
| Compound Name | 2-amino-3-[[cyclohexyl(methyl)amino]methyl]-5-(methylaminomethyl)cyclohexa-2,4-diene-1-thiol |
| PubChem CID | 163634676 |
| Molecular Formula | C16H29N3S |
| Molecular Weight | 295.50 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 2-amino-3-[[cyclohexyl(methyl)amino]methyl]-5-(methylaminomethyl)cyclohexa-2,4-diene-1-thiol |
| SMILES | CNCC1=CC(CN(C)C2CCCCC2)=C(N)C(S)C1 |
| InChI | InChI=1S/C16H29N3S/c1-18-10-12-8-13(16(17)15(20)9-12)11-19(2)14-6-4-3-5-7-14/h8,14-15,18,20H,3-7,9-11,17H2,1-2H3 |
| InChIKey | HZBJRKCMKRKGTB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.50 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-[[cyclohexyl(methyl)amino]methyl]-5-(methylaminomethyl)cyclohexa-2,4-diene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-[[cyclohexyl(methyl)amino]methyl]-5-(methylaminomethyl)cyclohexa-2,4-diene-1-thiol?
The IUPAC name of 2-amino-3-[[cyclohexyl(methyl)amino]methyl]-5-(methylaminomethyl)cyclohexa-2,4-diene-1-thiol (CID 163634676) is 2-amino-3-[[cyclohexyl(methyl)amino]methyl]-5-(methylaminomethyl)cyclohexa-2,4-diene-1-thiol.
What is the SMILES notation for 2-amino-3-[[cyclohexyl(methyl)amino]methyl]-5-(methylaminomethyl)cyclohexa-2,4-diene-1-thiol?
The canonical SMILES for 2-amino-3-[[cyclohexyl(methyl)amino]methyl]-5-(methylaminomethyl)cyclohexa-2,4-diene-1-thiol is CNCC1=CC(CN(C)C2CCCCC2)=C(N)C(S)C1.
What is the InChIKey of 2-amino-3-[[cyclohexyl(methyl)amino]methyl]-5-(methylaminomethyl)cyclohexa-2,4-diene-1-thiol?
The InChIKey is HZBJRKCMKRKGTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29N3S/c1-18-10-12-8-13(16(17)15(20)9-12)11-19(2)14-6-4-3-5-7-14/h8,14-15,18,20H,3-7,9-11,17H2,1-2H3.
What are the key properties of 2-amino-3-[[cyclohexyl(methyl)amino]methyl]-5-(methylaminomethyl)cyclohexa-2,4-diene-1-thiol?
2-amino-3-[[cyclohexyl(methyl)amino]methyl]-5-(methylaminomethyl)cyclohexa-2,4-diene-1-thiol has a molecular weight of 295.50 g/mol, XLogP of 2.31, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[[cyclohexyl(methyl)amino]methyl]-5-(methylaminomethyl)cyclohexa-2,4-diene-1-thiol is sourced from PubChem (CID 163634676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).