C14H9NS — CID 163634840
16-thia-14-azatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8,11(15),12-heptaene (PubChem CID 163634840) has the molecular formula C14H9NS and a molecular weight of 223.30 g/mol. Its IUPAC name is 16-thia-14-azatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8,11(15),12-heptaene.
| Compound Name | 16-thia-14-azatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8,11(15),12-heptaene |
|---|---|
| PubChem CID | 163634840 |
| Molecular Formula | C14H9NS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 16-thia-14-azatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8,11(15),12-heptaene |
| SMILES | c1ccc2c(c1)ccc1c3cc[nH]c3sc21 |
| InChI | InChI=1S/C14H9NS/c1-2-4-10-9(3-1)5-6-11-12-7-8-15-14(12)16-13(10)11/h1-8,15H |
| InChIKey | HZEWUWVHWBXYGO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |