C14H27N3O4S — CID 163635009
3-[1-(3-propan-2-yl-2,5-dihydro-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propyl methanesulfonate (PubChem CID 163635009) has the molecular formula C14H27N3O4S and a molecular weight of 333.45 g/mol. Its IUPAC name is 3-[1-(3-propan-2-yl-2,5-dihydro-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propyl methanesulfonate.
| Compound Name | 3-[1-(3-propan-2-yl-2,5-dihydro-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propyl methanesulfonate |
|---|---|
| PubChem CID | 163635009 |
| Molecular Formula | C14H27N3O4S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 3-[1-(3-propan-2-yl-2,5-dihydro-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propyl methanesulfonate |
| SMILES | CC(C)C1=NC(N2CCC(CCCOS(C)(=O)=O)CC2)ON1 |
| InChI | InChI=1S/C14H27N3O4S/c1-11(2)13-15-14(21-16-13)17-8-6-12(7-9-17)5-4-10-20-22(3,18)19/h11-12,14H,4-10H2,1-3H3,(H,15,16) |
| InChIKey | HZIGSCMTRZMOJW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|